C19H26O4 — CID 23465660
methyl 3-(2-hexyl-4-oxo-2,3-dihydrochromen-3-yl)propanoate (PubChem CID 23465660) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 3-(2-hexyl-4-oxo-2,3-dihydrochromen-3-yl)propanoate.
| Compound Name | methyl 3-(2-hexyl-4-oxo-2,3-dihydrochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 23465660 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 3-(2-hexyl-4-oxo-2,3-dihydrochromen-3-yl)propanoate |
| SMILES | CCCCCCC1Oc2ccccc2C(=O)C1CCC(=O)OC |
| InChI | InChI=1S/C19H26O4/c1-3-4-5-6-10-17-15(12-13-18(20)22-2)19(21)14-9-7-8-11-16(14)23-17/h7-9,11,15,17H,3-6,10,12-13H2,1-2H3 |
| InChIKey | GCQXYUONLHWXRT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|