C40H72O8 — CID 158069393
methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate;methyl 8-[(2S,3S)-3-octyl-4-oxooxetan-2-yl]octanoate (PubChem CID 158069393) has the molecular formula C40H72O8 and a molecular weight of 681.01 g/mol. Its IUPAC name is methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate;methyl 8-[(2S,3S)-3-octyl-4-oxooxetan-2-yl]octanoate.
| Compound Name | methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate;methyl 8-[(2S,3S)-3-octyl-4-oxooxetan-2-yl]octanoate |
|---|---|
| PubChem CID | 158069393 |
| Molecular Formula | C40H72O8 |
| Molecular Weight | 681.01 g/mol |
| Exact Mass | 680.52 |
| IUPAC Name | methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate;methyl 8-[(2S,3S)-3-octyl-4-oxooxetan-2-yl]octanoate |
| SMILES | CCCCCCCC[C@@H]1C(=O)O[C@H]1CCCCCCCC(=O)OC.CCCCCCCC[C@H]1OC(=O)[C@@H]1CCCCCCCC(=O)OC |
| InChI | InChI=1S/2C20H36O4/c1-3-4-5-6-9-12-15-18-17(20(22)24-18)14-11-8-7-10-13-16-19(21)23-2;1-3-4-5-6-8-11-14-17-18(24-20(17)22)15-12-9-7-10-13-16-19(21)23-2/h2*17-18H,3-16H2,1-2H3/t2*17-,18-/m10/s1 |
| InChIKey | FLQHAFQUXFBEPU-PTQCACIQSA-N |
| XLogP | 10.36 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.01 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|