C20H38O2 — CID 146344694
(3S,4S)-4-nonyl-3-octyloxetan-2-one (PubChem CID 146344694) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (3S,4S)-4-nonyl-3-octyloxetan-2-one.
| Compound Name | (3S,4S)-4-nonyl-3-octyloxetan-2-one |
|---|---|
| PubChem CID | 146344694 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (3S,4S)-4-nonyl-3-octyloxetan-2-one |
| SMILES | CCCCCCCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC |
| InChI | InChI=1S/C20H38O2/c1-3-5-7-9-11-13-15-17-19-18(20(21)22-19)16-14-12-10-8-6-4-2/h18-19H,3-17H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | WKNLQRMGJHHPFV-OALUTQOASA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|