C18H32O4 — CID 158137059
(3S,4R)-3-methyl-4-pentyloxetan-2-one;(3S,4R)-4-methyl-3-pentyloxetan-2-one (PubChem CID 158137059) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-pentyloxetan-2-one;(3S,4R)-4-methyl-3-pentyloxetan-2-one.
| Compound Name | (3S,4R)-3-methyl-4-pentyloxetan-2-one;(3S,4R)-4-methyl-3-pentyloxetan-2-one |
|---|---|
| PubChem CID | 158137059 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (3S,4R)-3-methyl-4-pentyloxetan-2-one;(3S,4R)-4-methyl-3-pentyloxetan-2-one |
| SMILES | CCCCC[C@@H]1C(=O)O[C@@H]1C.CCCCC[C@H]1OC(=O)[C@H]1C |
| InChI | InChI=1S/2C9H16O2/c1-3-4-5-6-8-7(2)11-9(8)10;1-3-4-5-6-8-7(2)9(10)11-8/h2*7-8H,3-6H2,1-2H3/t2*7-,8+/m10/s1 |
| InChIKey | FTLWWWZVAFIBHZ-RXZNUWRWSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|