C22H42O3 — CID 87146053
(3S,4S)-4-[(2S)-2-hydroxynonyl]-3-(8-methylnonyl)oxetan-2-one (PubChem CID 87146053) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is (3S,4S)-4-[(2S)-2-hydroxynonyl]-3-(8-methylnonyl)oxetan-2-one.
| Compound Name | (3S,4S)-4-[(2S)-2-hydroxynonyl]-3-(8-methylnonyl)oxetan-2-one |
|---|---|
| PubChem CID | 87146053 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | (3S,4S)-4-[(2S)-2-hydroxynonyl]-3-(8-methylnonyl)oxetan-2-one |
| SMILES | CCCCCCC[C@H](O)C[C@@H]1OC(=O)[C@H]1CCCCCCCC(C)C |
| InChI | InChI=1S/C22H42O3/c1-4-5-6-8-12-15-19(23)17-21-20(22(24)25-21)16-13-10-7-9-11-14-18(2)3/h18-21,23H,4-17H2,1-3H3/t19-,20-,21-/m0/s1 |
| InChIKey | QUYKOGHNCDRUOE-ACRUOGEOSA-N |
| XLogP | 6.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|