About (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane
(3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane (PubChem CID 158289159) has the molecular formula C25H48O4
and a molecular weight of 412.66 g/mol. Its IUPAC name is (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane.
Molecular Properties
| Compound Name | (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane |
| PubChem CID | 158289159 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane |
| SMILES | C.CCCCC[C@H]1OC(=O)[C@@H]1CCCC.CCCCC[C@H]1OC(=O)[C@H]1CCCC |
| InChI | InChI=1S/2C12H22O2.CH4/c2*1-3-5-7-9-11-10(8-6-4-2)12(13)14-11;/h2*10-11H,3-9H2,1-2H3;1H4/t10-,11+;10-,11-;/m01./s1 |
| InChIKey | GLDKNZHUKLUHLZ-ASOKOMSVSA-N |
| XLogP | 7.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane?
The IUPAC name of (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane (CID 158289159) is (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane.
What is the SMILES notation for (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane?
The canonical SMILES for (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane is C.CCCCC[C@H]1OC(=O)[C@@H]1CCCC.CCCCC[C@H]1OC(=O)[C@H]1CCCC.
What is the InChIKey of (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane?
The InChIKey is GLDKNZHUKLUHLZ-ASOKOMSVSA-N. The full InChI is InChI=1S/2C12H22O2.CH4/c2*1-3-5-7-9-11-10(8-6-4-2)12(13)14-11;/h2*10-11H,3-9H2,1-2H3;1H4/t10-,11+;10-,11-;/m01./s1.
What are the key properties of (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane?
(3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane has a molecular weight of 412.66 g/mol, XLogP of 7.23, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-butyl-4-pentyloxetan-2-one;(3R,4R)-3-butyl-4-pentyloxetan-2-one;methane is sourced from PubChem (CID 158289159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).