C15H28O2 — CID 10752571
(3R,4S,5S)-4-methyl-3,5-dipentyloxolan-2-one (PubChem CID 10752571) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3R,4S,5S)-4-methyl-3,5-dipentyloxolan-2-one.
| Compound Name | (3R,4S,5S)-4-methyl-3,5-dipentyloxolan-2-one |
|---|---|
| PubChem CID | 10752571 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3R,4S,5S)-4-methyl-3,5-dipentyloxolan-2-one |
| SMILES | CCCCC[C@@H]1OC(=O)[C@H](CCCCC)[C@@H]1C |
| InChI | InChI=1S/C15H28O2/c1-4-6-8-10-13-12(3)14(17-15(13)16)11-9-7-5-2/h12-14H,4-11H2,1-3H3/t12-,13+,14-/m0/s1 |
| InChIKey | ZZOOOVUFOHHEQC-MJBXVCDLSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|