C22H43NO2S — CID 56641600
(3R,4R)-3-decyl-4-[4-[3-(dimethylamino)propylsulfanyl]butyl]oxetan-2-one (PubChem CID 56641600) has the molecular formula C22H43NO2S and a molecular weight of 385.66 g/mol. Its IUPAC name is (3R,4R)-3-decyl-4-[4-[3-(dimethylamino)propylsulfanyl]butyl]oxetan-2-one.
| Compound Name | (3R,4R)-3-decyl-4-[4-[3-(dimethylamino)propylsulfanyl]butyl]oxetan-2-one |
|---|---|
| PubChem CID | 56641600 |
| Molecular Formula | C22H43NO2S |
| Molecular Weight | 385.66 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (3R,4R)-3-decyl-4-[4-[3-(dimethylamino)propylsulfanyl]butyl]oxetan-2-one |
| SMILES | CCCCCCCCCC[C@H]1C(=O)O[C@@H]1CCCCSCCCN(C)C |
| InChI | InChI=1S/C22H43NO2S/c1-4-5-6-7-8-9-10-11-15-20-21(25-22(20)24)16-12-13-18-26-19-14-17-23(2)3/h20-21H,4-19H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | JAXATDPWMXBYMJ-NHCUHLMSSA-N |
| XLogP | 5.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|