C11H20O2 — CID 86576801
(3S,4S)-3-pentyl-4-propyloxetan-2-one (PubChem CID 86576801) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3S,4S)-3-pentyl-4-propyloxetan-2-one.
| Compound Name | (3S,4S)-3-pentyl-4-propyloxetan-2-one |
|---|---|
| PubChem CID | 86576801 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3S,4S)-3-pentyl-4-propyloxetan-2-one |
| SMILES | CCCCC[C@@H]1C(=O)O[C@H]1CCC |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-8-9-10(7-4-2)13-11(9)12/h9-10H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | XJPHBIOQDQXCIO-UWVGGRQHSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|