C39H72O7 — CID 158480835
methyl 8-[(2S,3S)-3-octyloxiran-2-yl]octanoate;methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate (PubChem CID 158480835) has the molecular formula C39H72O7 and a molecular weight of 653.00 g/mol. Its IUPAC name is methyl 8-[(2S,3S)-3-octyloxiran-2-yl]octanoate;methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate.
| Compound Name | methyl 8-[(2S,3S)-3-octyloxiran-2-yl]octanoate;methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate |
|---|---|
| PubChem CID | 158480835 |
| Molecular Formula | C39H72O7 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.53 |
| IUPAC Name | methyl 8-[(2S,3S)-3-octyloxiran-2-yl]octanoate;methyl 8-[(2R,3R)-2-octyl-4-oxooxetan-3-yl]octanoate |
| SMILES | CCCCCCCC[C@@H]1O[C@H]1CCCCCCCC(=O)OC.CCCCCCCC[C@H]1OC(=O)[C@@H]1CCCCCCCC(=O)OC |
| InChI | InChI=1S/C20H36O4.C19H36O3/c1-3-4-5-6-9-12-15-18-17(20(22)24-18)14-11-8-7-10-13-16-19(21)23-2;1-3-4-5-6-8-11-14-17-18(22-17)15-12-9-7-10-13-16-19(20)21-2/h17-18H,3-16H2,1-2H3;17-18H,3-16H2,1-2H3/t2*17-,18-/m10/s1 |
| InChIKey | HHMSAYZYJOGSLB-PTQCACIQSA-N |
| XLogP | 10.59 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|