C27H35NO5 — CID 87901115
5-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]pentyl-(2-phenoxyphenyl)carbamic acid (PubChem CID 87901115) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is 5-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]pentyl-(2-phenoxyphenyl)carbamic acid.
| Compound Name | 5-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]pentyl-(2-phenoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 87901115 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 5-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]pentyl-(2-phenoxyphenyl)carbamic acid |
| SMILES | CCCCCC[C@@H]1C(=O)O[C@H]1CCCCCN(C(=O)O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C27H35NO5/c1-2-3-4-9-16-22-24(33-26(22)29)18-10-6-13-20-28(27(30)31)23-17-11-12-19-25(23)32-21-14-7-5-8-15-21/h5,7-8,11-12,14-15,17,19,22,24H,2-4,6,9-10,13,16,18,20H2,1H3,(H,30,31)/t22-,24-/m0/s1 |
| InChIKey | FHHSEOFJAZVQSX-UPVQGACJSA-N |
| XLogP | 7.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|