C26H33NO5 — CID 11259221
5-(4-oxo-3-pentyloxetan-2-yl)pentyl N-(2-phenoxyphenyl)carbamate (PubChem CID 11259221) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is 5-(4-oxo-3-pentyloxetan-2-yl)pentyl N-(2-phenoxyphenyl)carbamate.
| Compound Name | 5-(4-oxo-3-pentyloxetan-2-yl)pentyl N-(2-phenoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11259221 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 5-(4-oxo-3-pentyloxetan-2-yl)pentyl N-(2-phenoxyphenyl)carbamate |
| SMILES | CCCCCC1C(=O)OC1CCCCCOC(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H33NO5/c1-2-3-6-15-21-23(32-25(21)28)17-9-5-12-19-30-26(29)27-22-16-10-11-18-24(22)31-20-13-7-4-8-14-20/h4,7-8,10-11,13-14,16,18,21,23H,2-3,5-6,9,12,15,17,19H2,1H3,(H,27,29) |
| InChIKey | DUGYGDCNVLMUSF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|