C19H36O3 — CID 11077856
(3S,4R,5R)-4-hydroxy-5-methyl-3-tetradecyloxolan-2-one (PubChem CID 11077856) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (3S,4R,5R)-4-hydroxy-5-methyl-3-tetradecyloxolan-2-one.
| Compound Name | (3S,4R,5R)-4-hydroxy-5-methyl-3-tetradecyloxolan-2-one |
|---|---|
| PubChem CID | 11077856 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (3S,4R,5R)-4-hydroxy-5-methyl-3-tetradecyloxolan-2-one |
| SMILES | CCCCCCCCCCCCCC[C@@H]1C(=O)O[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C19H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(20)16(2)22-19(17)21/h16-18,20H,3-15H2,1-2H3/t16-,17+,18+/m1/s1 |
| InChIKey | BEEKFGLUGMQFSX-SQNIBIBYSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|