C20H36O3 — CID 173349382
(3S,4S)-3-but-2-enyl-4-(2-hydroxytridecyl)oxetan-2-one (PubChem CID 173349382) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (3S,4S)-3-but-2-enyl-4-(2-hydroxytridecyl)oxetan-2-one.
| Compound Name | (3S,4S)-3-but-2-enyl-4-(2-hydroxytridecyl)oxetan-2-one |
|---|---|
| PubChem CID | 173349382 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (3S,4S)-3-but-2-enyl-4-(2-hydroxytridecyl)oxetan-2-one |
| SMILES | CC=CC[C@@H]1C(=O)O[C@H]1CC(O)CCCCCCCCCCC |
| InChI | InChI=1S/C20H36O3/c1-3-5-7-8-9-10-11-12-13-14-17(21)16-19-18(15-6-4-2)20(22)23-19/h4,6,17-19,21H,3,5,7-16H2,1-2H3/t17?,18-,19-/m0/s1 |
| InChIKey | GNCPRJPXYGFOQZ-MNNMKWMVSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|