C10H13NO4S — CID 129078525
3-ethyl-2-methyl-2H-1,3-benzoxazole-5-sulfonic acid (PubChem CID 129078525) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 3-ethyl-2-methyl-2H-1,3-benzoxazole-5-sulfonic acid.
| Compound Name | 3-ethyl-2-methyl-2H-1,3-benzoxazole-5-sulfonic acid |
|---|---|
| PubChem CID | 129078525 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-ethyl-2-methyl-2H-1,3-benzoxazole-5-sulfonic acid |
| SMILES | CCN1c2cc(S(=O)(=O)O)ccc2OC1C |
| InChI | InChI=1S/C10H13NO4S/c1-3-11-7(2)15-10-5-4-8(6-9(10)11)16(12,13)14/h4-7H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | OWLWOEWVGJHIRI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|