C13H13NO3 — CID 117064119
2-[(3,3-dimethyloxiran-2-yl)methyl]isoindole-1,3-dione (PubChem CID 117064119) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[(3,3-dimethyloxiran-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3,3-dimethyloxiran-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 117064119 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[(3,3-dimethyloxiran-2-yl)methyl]isoindole-1,3-dione |
| SMILES | CC1(C)OC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13NO3/c1-13(2)10(17-13)7-14-11(15)8-5-3-4-6-9(8)12(14)16/h3-6,10H,7H2,1-2H3 |
| InChIKey | FDYCHVHZAJYZNL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|