C16H19NO6 — CID 10567761
2-[[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione (PubChem CID 10567761) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10567761 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[[(4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)O[C@H]([C@H](O)CO)[C@H](CN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C16H19NO6/c1-16(2)22-12(13(23-16)11(19)8-18)7-17-14(20)9-5-3-4-6-10(9)15(17)21/h3-6,11-13,18-19H,7-8H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | NGUKMHWORIAKDF-FRRDWIJNSA-N |
| XLogP | 0.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|