C24H31NO8 — CID 176836981
2-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione (PubChem CID 176836981) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 176836981 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[[5-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)OCC(C2OC(C)(C)OC2C2OC(C)(C)OC2CN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C24H31NO8/c1-22(2)28-12-16(30-22)18-19(33-24(5,6)32-18)17-15(29-23(3,4)31-17)11-25-20(26)13-9-7-8-10-14(13)21(25)27/h7-10,15-19H,11-12H2,1-6H3 |
| InChIKey | LGKWLSSEJOGKRI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|