C25H28O6 — CID 11247285
(3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(9H-fluoren-9-yloxy)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 11247285) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is (3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(9H-fluoren-9-yloxy)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(9H-fluoren-9-yloxy)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11247285 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(9H-fluoren-9-yloxy)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OC1c3ccccc3-c3ccccc31)O[C@@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H28O6/c1-24(2)26-13-18(29-24)20-21-22(31-25(3,4)30-21)23(28-20)27-19-16-11-7-5-9-14(16)15-10-6-8-12-17(15)19/h5-12,18-23H,13H2,1-4H3/t18-,20-,21+,22+,23+/m1/s1 |
| InChIKey | BXDCZHXBVMFUJE-HMWDHGCWSA-N |
| XLogP | 4.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |