C16H23NO6S2 — CID 11211448
3-[[(3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-4-methyl-1,3-thiazole-2-thione (PubChem CID 11211448) has the molecular formula C16H23NO6S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[[(3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-4-methyl-1,3-thiazole-2-thione.
| Compound Name | 3-[[(3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-4-methyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 11211448 |
| Molecular Formula | C16H23NO6S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-[[(3aS,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-4-methyl-1,3-thiazole-2-thione |
| SMILES | Cc1csc(=S)n1O[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H23NO6S2/c1-8-7-25-14(24)17(8)23-13-12-11(21-16(4,5)22-12)10(19-13)9-6-18-15(2,3)20-9/h7,9-13H,6H2,1-5H3/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | NZOGCOHZYWWTMK-BNDIWNMDSA-N |
| XLogP | 2.41 |
| TPSA | 60.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|