C20H23NO10S — CID 146807808
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 1,3-dioxoisoindole-2-sulfonate (PubChem CID 146807808) has the molecular formula C20H23NO10S and a molecular weight of 469.47 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 1,3-dioxoisoindole-2-sulfonate.
| Compound Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 1,3-dioxoisoindole-2-sulfonate |
|---|---|
| PubChem CID | 146807808 |
| Molecular Formula | C20H23NO10S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 1,3-dioxoisoindole-2-sulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS(=O)(=O)N4C(=O)c5ccccc5C4=O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C20H23NO10S/c1-18(2)28-13-9-26-20(15(14(13)29-18)30-19(3,4)31-20)10-27-32(24,25)21-16(22)11-7-5-6-8-12(11)17(21)23/h5-8,13-15H,9-10H2,1-4H3/t13-,14-,15+,20+/m1/s1 |
| InChIKey | RZLQRLBIOVPXOT-ZOZBEKFXSA-N |
| XLogP | 0.94 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|