C24H30NO9PS — CID 10414885
[(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-diphenylphosphorylsulfamate (PubChem CID 10414885) has the molecular formula C24H30NO9PS and a molecular weight of 539.54 g/mol. Its IUPAC name is [(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-diphenylphosphorylsulfamate.
| Compound Name | [(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-diphenylphosphorylsulfamate |
|---|---|
| PubChem CID | 10414885 |
| Molecular Formula | C24H30NO9PS |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | [(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-diphenylphosphorylsulfamate |
| SMILES | CC1(C)OC2CO[C@@]3(COS(=O)(=O)NP(=O)(c4ccccc4)c4ccccc4)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C24H30NO9PS/c1-22(2)31-19-15-29-24(21(20(19)32-22)33-23(3,4)34-24)16-30-36(27,28)25-35(26,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-21H,15-16H2,1-4H3,(H,25,26)/t19?,20?,21?,24-/m0/s1 |
| InChIKey | VVMCDMROSSUFTP-HFHBMHTISA-N |
| XLogP | 2.16 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|