C16H27NO10S — CID 10071051
4-[[(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylamino]butanoic acid (PubChem CID 10071051) has the molecular formula C16H27NO10S and a molecular weight of 425.46 g/mol. Its IUPAC name is 4-[[(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylamino]butanoic acid.
| Compound Name | 4-[[(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 10071051 |
| Molecular Formula | C16H27NO10S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[[(6S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylamino]butanoic acid |
| SMILES | CC1(C)OC2CO[C@@]3(COS(=O)(=O)NCCCC(=O)O)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C16H27NO10S/c1-14(2)24-10-8-22-16(13(12(10)25-14)26-15(3,4)27-16)9-23-28(20,21)17-7-5-6-11(18)19/h10,12-13,17H,5-9H2,1-4H3,(H,18,19)/t10?,12?,13?,16-/m0/s1 |
| InChIKey | LWPKABNZJFVWMF-ZNISXCAESA-N |
| XLogP | 0.10 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|