C13H19F3NO10S2- — CID 58649054
[(2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 58649054) has the molecular formula C13H19F3NO10S2- and a molecular weight of 470.42 g/mol. Its IUPAC name is [(2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [(2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 58649054 |
| Molecular Formula | C13H19F3NO10S2- |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | [(2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC1(C)OC2[C@@H](CO[C@@]3(COS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C13H19F3NO10S2/c1-10(2)24-7-5-22-12(9(8(7)25-10)26-11(3,4)27-12)6-23-29(20,21)17-28(18,19)13(14,15)16/h7-9H,5-6H2,1-4H3/q-1/t7-,8?,9+,12+/m1/s1 |
| InChIKey | AGUZNQAUAPOHAY-FKIWMHTNSA-N |
| XLogP | 0.87 |
| TPSA | 137.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |