C15H27NO10S — CID 21029654
sulfamic acid;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl propanoate (PubChem CID 21029654) has the molecular formula C15H27NO10S and a molecular weight of 413.45 g/mol. Its IUPAC name is sulfamic acid;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl propanoate.
| Compound Name | sulfamic acid;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl propanoate |
|---|---|
| PubChem CID | 21029654 |
| Molecular Formula | C15H27NO10S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | sulfamic acid;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@@]12OC[C@H]3OC(C)(C)O[C@H]3[C@@H]1OC(C)(C)O2.NS(=O)(=O)O |
| InChI | InChI=1S/C15H24O7.H3NO3S/c1-6-10(16)17-8-15-12(21-14(4,5)22-15)11-9(7-18-15)19-13(2,3)20-11;1-5(2,3)4/h9,11-12H,6-8H2,1-5H3;(H3,1,2,3,4)/t9-,11-,12+,15+;/m1./s1 |
| InChIKey | YEXSYLQTHLICAD-DZEJJOSQSA-N |
| XLogP | 0.09 |
| TPSA | 152.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|