C12H21NO8S — CID 16757856
[(6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate (PubChem CID 16757856) has the molecular formula C12H21NO8S and a molecular weight of 339.37 g/mol. Its IUPAC name is [(6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate.
| Compound Name | [(6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 16757856 |
| Molecular Formula | C12H21NO8S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [(6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
| SMILES | CC1(C)OC2CO[C@]3(COS(N)(=O)=O)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7?,8?,9?,12-/m1/s1 |
| InChIKey | KJADKKWYZYXHBB-ROBJAFKPSA-N |
| XLogP | -0.40 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |