C13H25NO8S — CID 142923351
ethane;(4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methyl sulfamate (PubChem CID 142923351) has the molecular formula C13H25NO8S and a molecular weight of 355.41 g/mol. Its IUPAC name is ethane;(4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methyl sulfamate.
| Compound Name | ethane;(4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methyl sulfamate |
|---|---|
| PubChem CID | 142923351 |
| Molecular Formula | C13H25NO8S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethane;(4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methyl sulfamate |
| SMILES | CC.CC1OC2COC3(COS(N)(=O)=O)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C11H19NO8S.C2H6/c1-6-17-7-4-15-11(5-16-21(12,13)14)9(8(7)18-6)19-10(2,3)20-11;1-2/h6-9H,4-5H2,1-3H3,(H2,12,13,14);1-2H3 |
| InChIKey | JARNHABJSGRHSB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |