C14H24N2O10S2 — CID 10623153
tert-butyl (NE)-N-[(1S,2S,4S,6R,9S)-11,11-dimethyl-9-(sulfamoyloxymethyl)-3,5,8,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecan-4-ylidene]carbamate (PubChem CID 10623153) has the molecular formula C14H24N2O10S2 and a molecular weight of 444.48 g/mol. Its IUPAC name is tert-butyl (NE)-N-[(1S,2S,4S,6R,9S)-11,11-dimethyl-9-(sulfamoyloxymethyl)-3,5,8,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecan-4-ylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[(1S,2S,4S,6R,9S)-11,11-dimethyl-9-(sulfamoyloxymethyl)-3,5,8,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecan-4-ylidene]carbamate |
|---|---|
| PubChem CID | 10623153 |
| Molecular Formula | C14H24N2O10S2 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | tert-butyl (NE)-N-[(1S,2S,4S,6R,9S)-11,11-dimethyl-9-(sulfamoyloxymethyl)-3,5,8,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecan-4-ylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=[S@@]1/O[C@@H]2[C@@H](CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C14H24N2O10S2/c1-12(2,3)23-11(17)16-27-24-8-6-20-14(7-21-28(15,18)19)10(9(8)25-27)22-13(4,5)26-14/h8-10H,6-7H2,1-5H3,(H2,15,18,19)/t8-,9-,10+,14+,27+/m1/s1 |
| InChIKey | UCWKJHYBNHZGEL-FEXSDUAOSA-N |
| XLogP | 0.44 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |