C12H21NO9S — CID 171035489
[(6S,11S)-11-(hydroxymethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate (PubChem CID 171035489) has the molecular formula C12H21NO9S and a molecular weight of 355.37 g/mol. Its IUPAC name is [(6S,11S)-11-(hydroxymethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate.
| Compound Name | [(6S,11S)-11-(hydroxymethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 171035489 |
| Molecular Formula | C12H21NO9S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [(6S,11S)-11-(hydroxymethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
| SMILES | CC1(C)OC2C3O[C@@](C)(CO)OC3CO[C@@]2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C12H21NO9S/c1-10(2)21-9-8-7(19-11(3,5-14)20-8)4-17-12(9,22-10)6-18-23(13,15)16/h7-9,14H,4-6H2,1-3H3,(H2,13,15,16)/t7?,8?,9?,11-,12-/m0/s1 |
| InChIKey | RWNDWLAEFHRSEG-AKPDGQEHSA-N |
| XLogP | -1.42 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |