C18H29NO8S — CID 10574106
CID 10574106 (PubChem CID 10574106) has the molecular formula C18H29NO8S and a molecular weight of 419.50 g/mol.
| Compound Name | CID 10574106 |
|---|---|
| PubChem CID | 10574106 |
| Molecular Formula | C18H29NO8S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)OC[C@@]12OC[C@H]3OC4(CCCCC4)O[C@H]3[C@@H]1OC1(CCCCC1)O2 |
| InChI | InChI=1S/C18H29NO8S/c19-28(20,21)23-12-18-15(26-17(27-18)9-5-2-6-10-17)14-13(11-22-18)24-16(25-14)7-3-1-4-8-16/h13-15H,1-12H2,(H2,19,20,21)/t13-,14-,15+,18+/m1/s1 |
| InChIKey | SOTOYLQDIJLFAI-BSXFFOKHSA-N |
| XLogP | 1.45 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |