C12H21NO9S — CID 10498387
[(1R,2S,6S,9R,11S)-11-ethoxy-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate (PubChem CID 10498387) has the molecular formula C12H21NO9S and a molecular weight of 355.37 g/mol. Its IUPAC name is [(1R,2S,6S,9R,11S)-11-ethoxy-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate.
| Compound Name | [(1R,2S,6S,9R,11S)-11-ethoxy-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 10498387 |
| Molecular Formula | C12H21NO9S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [(1R,2S,6S,9R,11S)-11-ethoxy-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
| SMILES | CCO[C@@H]1O[C@@H]2[C@@H](CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C12H21NO9S/c1-4-16-10-19-7-5-17-12(6-18-23(13,14)15)9(8(7)20-10)21-11(2,3)22-12/h7-10H,4-6H2,1-3H3,(H2,13,14,15)/t7-,8-,9+,10+,12+/m1/s1 |
| InChIKey | JIGNHDRSJHZXLS-RWHSBRQSSA-N |
| XLogP | -0.81 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |