C11H21NO8SSi — CID 10713205
[(1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,8,10,12-pentaoxa-4-silatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate (PubChem CID 10713205) has the molecular formula C11H21NO8SSi and a molecular weight of 355.44 g/mol. Its IUPAC name is [(1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,8,10,12-pentaoxa-4-silatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate.
| Compound Name | [(1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,8,10,12-pentaoxa-4-silatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
|---|---|
| PubChem CID | 10713205 |
| Molecular Formula | C11H21NO8SSi |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [(1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,8,10,12-pentaoxa-4-silatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@H]2[C@@H]3O[Si](C)(C)O[C@@H]3CO[C@@]2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C11H21NO8SSi/c1-10(2)17-9-8-7(18-22(3,4)19-8)5-15-11(9,20-10)6-16-21(12,13)14/h7-9H,5-6H2,1-4H3,(H2,12,13,14)/t7-,8-,9+,11+/m1/s1 |
| InChIKey | KBDGZILPBVHTSP-REIXXSIJSA-N |
| XLogP | -0.43 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|