C9H15NO10S2 — CID 5331
(11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl)methyl sulfamate (PubChem CID 5331) has the molecular formula C9H15NO10S2 and a molecular weight of 361.35 g/mol. Its IUPAC name is (11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl)methyl sulfamate.
| Compound Name | (11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl)methyl sulfamate |
|---|---|
| PubChem CID | 5331 |
| Molecular Formula | C9H15NO10S2 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl)methyl sulfamate |
| SMILES | CC1(C)OC2C3OS(=O)(=O)OC3COC2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C9H15NO10S2/c1-8(2)17-7-6-5(18-22(13,14)19-6)3-15-9(7,20-8)4-16-21(10,11)12/h5-7H,3-4H2,1-2H3,(H2,10,11,12) |
| InChIKey | GGOAQSGCBDRTHT-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |