C9H16N4O11S2 — CID 87397175
azido sulfamate;[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methanol (PubChem CID 87397175) has the molecular formula C9H16N4O11S2 and a molecular weight of 420.38 g/mol. Its IUPAC name is azido sulfamate;[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methanol.
| Compound Name | azido sulfamate;[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methanol |
|---|---|
| PubChem CID | 87397175 |
| Molecular Formula | C9H16N4O11S2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | azido sulfamate;[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methanol |
| SMILES | CC1(C)O[C@H]2[C@@H]3OS(=O)(=O)O[C@@H]3CO[C@@]2(CO)O1.[N-]=[N+]=NOS(N)(=O)=O |
| InChI | InChI=1S/C9H14O8S.H2N4O3S/c1-8(2)14-7-6-5(15-18(11,12)16-6)3-13-9(7,4-10)17-8;1-3-4-7-8(2,5)6/h5-7,10H,3-4H2,1-2H3;(H2,2,5,6)/t5-,6-,7+,9+;/m1./s1 |
| InChIKey | ZKBLIQSGJBJTMW-ITFAARPGSA-N |
| XLogP | -1.68 |
| TPSA | 218.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|