C20H27NO10S — CID 78426760
benzyl N-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl]carbamate (PubChem CID 78426760) has the molecular formula C20H27NO10S and a molecular weight of 473.50 g/mol. Its IUPAC name is benzyl N-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl]carbamate.
| Compound Name | benzyl N-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl]carbamate |
|---|---|
| PubChem CID | 78426760 |
| Molecular Formula | C20H27NO10S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | benzyl N-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonyl]carbamate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS(=O)(=O)NC(=O)OCc4ccccc4)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C20H27NO10S/c1-18(2)28-14-11-26-20(16(15(14)29-18)30-19(3,4)31-20)12-27-32(23,24)21-17(22)25-10-13-8-6-5-7-9-13/h5-9,14-16H,10-12H2,1-4H3,(H,21,22)/t14-,15-,16+,20+/m1/s1 |
| InChIKey | GLQVUHJMVHHGKH-DICRZQGBSA-N |
| XLogP | 1.57 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |