C16H21F3O8 — CID 11429428
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4,4,4-trifluoro-3-oxobutanoate (PubChem CID 11429428) has the molecular formula C16H21F3O8 and a molecular weight of 398.33 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 11429428 |
| Molecular Formula | C16H21F3O8 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl 4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COC(=O)CC(=O)C(F)(F)F)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C16H21F3O8/c1-13(2)24-8-6-23-15(7-22-10(21)5-9(20)16(17,18)19)12(11(8)25-13)26-14(3,4)27-15/h8,11-12H,5-7H2,1-4H3/t8-,11-,12+,15+/m1/s1 |
| InChIKey | QHPQRBZAXDRIMJ-NJQDOHAQSA-N |
| XLogP | 1.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|