C14H22O6 — CID 146165645
(1R,2S,6S,9R)-4,4,11,11-tetramethyl-6-(1,2,2-trideuterioethenoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 146165645) has the molecular formula C14H22O6 and a molecular weight of 289.34 g/mol. Its IUPAC name is (1R,2S,6S,9R)-4,4,11,11-tetramethyl-6-(1,2,2-trideuterioethenoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,9R)-4,4,11,11-tetramethyl-6-(1,2,2-trideuterioethenoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 146165645 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (1R,2S,6S,9R)-4,4,11,11-tetramethyl-6-(1,2,2-trideuterioethenoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | [2H]C([2H])=C([2H])OC[C@@]12OC[C@H]3OC(C)(C)O[C@H]3[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C14H22O6/c1-6-15-8-14-11(19-13(4,5)20-14)10-9(7-16-14)17-12(2,3)18-10/h6,9-11H,1,7-8H2,2-5H3/t9-,10-,11+,14+/m1/s1/i1D2,6D |
| InChIKey | HGVNZPIKVRIAIH-JADFDISBSA-N |
| XLogP | 1.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|