C17H34N2O9S — CID 159307366
2-hydroxyethyl(trimethyl)azanium;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylazanide (PubChem CID 159307366) has the molecular formula C17H34N2O9S and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylazanide.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylazanide |
|---|---|
| PubChem CID | 159307366 |
| Molecular Formula | C17H34N2O9S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxysulfonylazanide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS([NH-])(=O)=O)OC(C)(C)O[C@@H]23)O1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C12H20NO8S.C5H14NO/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12;1-6(2,3)4-5-7/h7-9H,5-6H2,1-4H3,(H-,13,14,15);7H,4-5H2,1-3H3/q-1;+1/t7-,8-,9+,12+;/m1./s1 |
| InChIKey | LCBXENKDSDHPEC-WGAVTJJLSA-N |
| XLogP | 0.38 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|