C28H34N2O6 — CID 131975360
1-benzyl-4-[[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,7-dimethylquinoxaline-2,3-dione (PubChem CID 131975360) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1-benzyl-4-[[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,7-dimethylquinoxaline-2,3-dione.
| Compound Name | 1-benzyl-4-[[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,7-dimethylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 131975360 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 1-benzyl-4-[[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,7-dimethylquinoxaline-2,3-dione |
| SMILES | Cc1cc2c(cc1C)n(C[C@@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)c(=O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C28H34N2O6/c1-17-12-20-21(13-18(17)2)30(26(32)25(31)29(20)14-19-10-8-7-9-11-19)15-22-24(36-28(5,6)34-22)23-16-33-27(3,4)35-23/h7-13,22-24H,14-16H2,1-6H3/t22-,23+,24-/m0/s1 |
| InChIKey | GVQYUIIBMNVWTH-VXNXHJTFSA-N |
| XLogP | 3.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|