C25H31O7P — CID 59585333
(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide (PubChem CID 59585333) has the molecular formula C25H31O7P and a molecular weight of 474.49 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide.
| Compound Name | (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 59585333 |
| Molecular Formula | C25H31O7P |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenyl-7-phenylmethoxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)OP(=O)(c3ccccc3)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C25H31O7P/c1-24(2)28-16-19(29-24)20-21-22(31-25(3,4)30-21)23(27-15-17-11-7-5-8-12-17)33(26,32-20)18-13-9-6-10-14-18/h5-14,19-23H,15-16H2,1-4H3/t19-,20-,21+,22+,23-,33?/m1/s1 |
| InChIKey | YDASLRWCAKWETP-IRGUSOQPSA-N |
| XLogP | 4.20 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|