C25H32NO6P — CID 170781320
(3aR,6S,7S,7aS)-N-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-amine (PubChem CID 170781320) has the molecular formula C25H32NO6P and a molecular weight of 473.51 g/mol. Its IUPAC name is (3aR,6S,7S,7aS)-N-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-amine.
| Compound Name | (3aR,6S,7S,7aS)-N-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-amine |
|---|---|
| PubChem CID | 170781320 |
| Molecular Formula | C25H32NO6P |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (3aR,6S,7S,7aS)-N-benzyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-amine |
| SMILES | CC1(C)OC[C@H](C2O[P@@](=O)(c3ccccc3)[C@H](NCc3ccccc3)[C@H]3OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C25H32NO6P/c1-24(2)28-16-19(29-24)20-21-22(31-25(3,4)30-21)23(26-15-17-11-7-5-8-12-17)33(27,32-20)18-13-9-6-10-14-18/h5-14,19-23,26H,15-16H2,1-4H3/t19-,20?,21+,22+,23+,33+/m1/s1 |
| InChIKey | SFTOZIBEPGKZDW-ZKDAVUIISA-N |
| XLogP | 3.78 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|