C19H27O7P — CID 59585334
(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-methylphenyl)-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-ol (PubChem CID 59585334) has the molecular formula C19H27O7P and a molecular weight of 398.39 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-methylphenyl)-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-ol.
| Compound Name | (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-methylphenyl)-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-ol |
|---|---|
| PubChem CID | 59585334 |
| Molecular Formula | C19H27O7P |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-methylphenyl)-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-ol |
| SMILES | Cc1cccc(P2(=O)O[C@H]([C@H]3COC(C)(C)O3)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2O)c1 |
| InChI | InChI=1S/C19H27O7P/c1-11-7-6-8-12(9-11)27(21)17(20)16-15(24-19(4,5)25-16)14(26-27)13-10-22-18(2,3)23-13/h6-9,13-17,20H,10H2,1-5H3/t13-,14-,15+,16+,17-,27?/m1/s1 |
| InChIKey | FKVJHLOISXQRGO-OAPKAYSXSA-N |
| XLogP | 2.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|