C24H30NO7P — CID 25155228
4-[[(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl]oxy]aniline (PubChem CID 25155228) has the molecular formula C24H30NO7P and a molecular weight of 475.48 g/mol. Its IUPAC name is 4-[[(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl]oxy]aniline.
| Compound Name | 4-[[(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl]oxy]aniline |
|---|---|
| PubChem CID | 25155228 |
| Molecular Formula | C24H30NO7P |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[[(3aR,4R,6R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinin-7-yl]oxy]aniline |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)O[P@](=O)(c3ccccc3)[C@@H](Oc3ccc(N)cc3)[C@H]2O1 |
| InChI | InChI=1S/C24H30NO7P/c1-23(2)27-14-18(29-23)19-20-21(31-24(3,4)30-20)22(28-16-12-10-15(25)11-13-16)33(26,32-19)17-8-6-5-7-9-17/h5-13,18-22H,14,25H2,1-4H3/t18-,19-,20+,21+,22-,33-/m1/s1 |
| InChIKey | VOQLGBUZFMSHHR-VVRVBYJRSA-N |
| XLogP | 3.65 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|