C21H31NO4P+ — CID 167105877
N-benzyl-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-oxo-3,3a,4,5,7,7a-hexahydrophosphinino[3,4-b]furan-6-ium-7-amine (PubChem CID 167105877) has the molecular formula C21H31NO4P+ and a molecular weight of 392.46 g/mol. Its IUPAC name is N-benzyl-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-oxo-3,3a,4,5,7,7a-hexahydrophosphinino[3,4-b]furan-6-ium-7-amine.
| Compound Name | N-benzyl-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-oxo-3,3a,4,5,7,7a-hexahydrophosphinino[3,4-b]furan-6-ium-7-amine |
|---|---|
| PubChem CID | 167105877 |
| Molecular Formula | C21H31NO4P+ |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-benzyl-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-oxo-3,3a,4,5,7,7a-hexahydrophosphinino[3,4-b]furan-6-ium-7-amine |
| SMILES | CC1(C)CC2C(C3COC(C)(C)O3)C[P+](=O)C(NCc3ccccc3)C2O1 |
| InChI | InChI=1S/C21H31NO4P/c1-20(2)10-15-16(17-12-24-21(3,4)25-17)13-27(23)19(18(15)26-20)22-11-14-8-6-5-7-9-14/h5-9,15-19,22H,10-13H2,1-4H3/q+1 |
| InChIKey | MIDADIUPTBSGHS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|