C20H27NO5 — CID 15953261
(1R,2S,6R,8S)-N-benzyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxamide (PubChem CID 15953261) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1R,2S,6R,8S)-N-benzyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxamide.
| Compound Name | (1R,2S,6R,8S)-N-benzyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxamide |
|---|---|
| PubChem CID | 15953261 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (1R,2S,6R,8S)-N-benzyl-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxamide |
| SMILES | CC1(C)OC[C@@H]2C[C@@]3(C(=O)NCc4ccccc4)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H27NO5/c1-18(2)23-12-14-10-20(16(15(14)24-18)25-19(3,4)26-20)17(22)21-11-13-8-6-5-7-9-13/h5-9,14-16H,10-12H2,1-4H3,(H,21,22)/t14-,15+,16-,20+/m0/s1 |
| InChIKey | VBYCMUALKWCBEY-KSVNGYGVSA-N |
| XLogP | 2.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |