C20H26O7 — CID 123850397
6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a-(phenylmethoxymethyl)-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 123850397) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a-(phenylmethoxymethyl)-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a-(phenylmethoxymethyl)-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 123850397 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a-(phenylmethoxymethyl)-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)OCC(C2OC(=O)C3(COCc4ccccc4)OC(C)(C)OC23)O1 |
| InChI | InChI=1S/C20H26O7/c1-18(2)23-11-14(25-18)15-16-20(17(21)24-15,27-19(3,4)26-16)12-22-10-13-8-6-5-7-9-13/h5-9,14-16H,10-12H2,1-4H3 |
| InChIKey | QXGCKBNETMJSRK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |