C20H28O6 — CID 134366274
(3aS,5R,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole (PubChem CID 134366274) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aS,5R,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 134366274 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3aS,5R,6R,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole |
| SMILES | CC1(C)OCC([C@H]2O[C@@]3(C)OC(C)(C)O[C@@H]3[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C20H28O6/c1-18(2)22-12-14(23-18)15-16(21-11-13-9-7-6-8-10-13)17-20(5,24-15)26-19(3,4)25-17/h6-10,14-17H,11-12H2,1-5H3/t14?,15-,16-,17-,20+/m1/s1 |
| InChIKey | ZEGMKFKHIQEZJS-YVQUPWMYSA-N |
| XLogP | 2.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |