C17H23NO4 — CID 42624749
(1S,5S,6S,7S,8R)-3,3-dimethyl-6-phenylmethoxy-2,4,11-trioxatricyclo[5.3.1.01,5]undecan-8-amine (PubChem CID 42624749) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (1S,5S,6S,7S,8R)-3,3-dimethyl-6-phenylmethoxy-2,4,11-trioxatricyclo[5.3.1.01,5]undecan-8-amine.
| Compound Name | (1S,5S,6S,7S,8R)-3,3-dimethyl-6-phenylmethoxy-2,4,11-trioxatricyclo[5.3.1.01,5]undecan-8-amine |
|---|---|
| PubChem CID | 42624749 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (1S,5S,6S,7S,8R)-3,3-dimethyl-6-phenylmethoxy-2,4,11-trioxatricyclo[5.3.1.01,5]undecan-8-amine |
| SMILES | CC1(C)O[C@H]2[C@@H](OCc3ccccc3)[C@H]3O[C@@]2(CC[C@H]3N)O1 |
| InChI | InChI=1S/C17H23NO4/c1-16(2)21-15-14(19-10-11-6-4-3-5-7-11)13-12(18)8-9-17(15,20-13)22-16/h3-7,12-15H,8-10,18H2,1-2H3/t12-,13+,14+,15+,17+/m1/s1 |
| InChIKey | CXXWFPZXELYCLH-MDLJMBGESA-N |
| XLogP | 1.94 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |