C17H19F3O8S — CID 10939097
[(3R,4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 10939097) has the molecular formula C17H19F3O8S and a molecular weight of 440.39 g/mol. Its IUPAC name is [(3R,4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10939097 |
| Molecular Formula | C17H19F3O8S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [(3R,4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(=O)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C17H19F3O8S/c1-16(2)25-9-11(27-16)12-13(24-8-10-6-4-3-5-7-10)14(15(21)26-12)28-29(22,23)17(18,19)20/h3-7,11-14H,8-9H2,1-2H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | CXOXHNBTIQBSOF-YIYPIFLZSA-N |
| XLogP | 1.88 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|