C21H21F3O8S — CID 100914933
[(3R,4R,5R)-5-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 100914933) has the molecular formula C21H21F3O8S and a molecular weight of 490.45 g/mol. Its IUPAC name is [(3R,4R,5R)-5-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,4R,5R)-5-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 100914933 |
| Molecular Formula | C21H21F3O8S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [(3R,4R,5R)-5-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-2-oxo-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | O=C1O[C@H]([C@@H](CO)OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H21F3O8S/c22-21(23,24)33(27,28)32-19-18(30-13-15-9-5-2-6-10-15)17(31-20(19)26)16(11-25)29-12-14-7-3-1-4-8-14/h1-10,16-19,25H,11-13H2/t16-,17-,18-,19-/m1/s1 |
| InChIKey | CQUOOYAXJVVWES-NCXUSEDFSA-N |
| XLogP | 2.31 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|